CAS 18620-73-0 appears in our catalog under these names: 2,4-Diamino-5-nitropyrimidine, 98%, 5–Nitropyrimidine–2,4–diamine, 2,4-Diamino-5-nitropyrimidine, 2,4-Diamino-5-nitropyrimidine 97%, 5-Nitropyrimidine-2,4-diamine, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
5-nitropyrimidine-2,4-diamine (CAS 18620-73-0) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-2,4-diamine. InChIKey: UUWYIIVPLIJDMQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-2,4-diamine |
| InChIKey | UUWYIIVPLIJDMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)