cas: 18620-73-0 — see every product listed under this CAS number, including other names
5-Nitropyrimidine-2,4-diamine, 95% (CAS 18620-73-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231735-1G |
| cas | 18620-73-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1768.15 Pln | |
| Fluorochem | 25g | 3402.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-nitropyrimidine-2,4-diamine (CAS 18620-73-0) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-2,4-diamine. InChIKey: UUWYIIVPLIJDMQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-2,4-diamine |
| InChIKey | UUWYIIVPLIJDMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)