cas: 18620-73-0 — see every product listed under this CAS number, including other names
5-Nitropyrimidine-2,4-diamine, 97%, 97% (CAS 18620-73-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MXG-100mg |
| cas | 18620-73-0 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 755.60 Pln | |
| Chemat | 25g | 2483.60 Pln | |
| Chemat | 10g | 1307.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-nitropyrimidine-2,4-diamine (CAS 18620-73-0) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-2,4-diamine. InChIKey: UUWYIIVPLIJDMQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-2,4-diamine |
| InChIKey | UUWYIIVPLIJDMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)