cas: 614-94-8 — see every product listed under this CAS number, including other names
2,4-Diaminoanisole Dihydrochloride, >99.0%(T) (CAS 614-94-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0074-5G |
| cas | 614-94-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 506.81 Pln | |
| TCI | 25g | 1750.87 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(T) |
4-methoxybenzene-1,3-diamine;dihydrochloride (CAS 614-94-8) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 4-methoxybenzene-1,3-diamine;dihydrochloride. InChIKey: FNGHHDCBSVSOOI-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-methoxybenzene-1,3-diamine;dihydrochloride |
| InChIKey | FNGHHDCBSVSOOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)