CAS 2270908-38-6 appears in our catalog under these names: 3-Amino-6-hydroxy-2,4-dimethylpyridine dihydrochloride, 95%, 5-Amino-4,6-dimethylpyridin-2-ol dihydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5-amino-4,6-dimethyl-1H-pyridin-2-one;dihydrochloride (CAS 2270908-38-6) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 5-amino-4,6-dimethyl-1H-pyridin-2-one;dihydrochloride. InChIKey: ZAQBNEFAKGLFGE-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 5-amino-4,6-dimethyl-1H-pyridin-2-one;dihydrochloride |
| InChIKey | ZAQBNEFAKGLFGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=C1N)C.Cl.Cl |
Computed by PubChem (NCBI)