CAS 59548-39-9 appears in our catalog under these names: 4-Methoxy-o-phenylenediamine dihydrochloride, 95%, 4–Methoxy–o–phenylenediamine dihydrochloride, 4-Methoxy-o-phenylenediamine dihydrochloride, 96% , 3,4-Diaminoanisole dihydrochloride, 98%, 4-Methoxybenzene-1,2-diamine dihydrochloride 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 10G, 1x100mg.
4-methoxybenzene-1,2-diamine;dihydrochloride (CAS 59548-39-9) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 4-methoxybenzene-1,2-diamine;dihydrochloride. InChIKey: SXCHMHOBHJOXGC-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-methoxybenzene-1,2-diamine;dihydrochloride |
| InChIKey | SXCHMHOBHJOXGC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)