Products 614-94-8
CAS 614-94-8 appears in our catalog under these names: 2,4-Diaminoanisole dihydrochloride, 95%, 4-Methoxybenzene-1,3-diamine dihydrochloride, 99%, 2,4-Diaminoanisole dihydrochloride, 2，4–Diaminoanisole Dihydrochloride, 4-methoxy benzene-1,3-diamine dihydrochloride. Offered by: Combi-blocks, AmBeed, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 0,5g, 10mg, 25mg.
4-methoxybenzene-1,3-diamine;dihydrochloride (CAS 614-94-8) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 4-methoxybenzene-1,3-diamine;dihydrochloride. InChIKey: FNGHHDCBSVSOOI-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-methoxybenzene-1,3-diamine;dihydrochloride |
| InChIKey | FNGHHDCBSVSOOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4-Diaminoanisole dihydrochloride, 2,4-Diaminoanisole hydrochloride, 4Methoxy1,3benzenediamine dihydrochloride, mPhenylenediamine, 4methoxy, dihydrochloride, 1,3Benzenediamine, 4methoxy, dihydrochloride, 4-methoxybenzene-1,3-diamine dihydrochloride, 4-methoxybenzene-1,3-diamine;dihydrochloride, m-Phenylenediamine, 4-methoxy-, dihydrochloride, 1,3-Benzenediamine, 4-methoxy-, dihydrochloride, 4-methoxy benzene-1,3-diamine 2hcl