cas: 81090-45-1 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-isopropylaniline 95% (CAS 81090-45-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A884284-1g |
| cas | 81090-45-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 1115.75 Pln | |
| Ambeed | 100g | 3212.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A884284 |
2,4-dibromo-6-propan-2-ylaniline (CAS 81090-45-1) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,4-dibromo-6-propan-2-ylaniline. InChIKey: OKIHDLUSXGDARZ-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,4-dibromo-6-propan-2-ylaniline |
| InChIKey | OKIHDLUSXGDARZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)