cas: 81090-45-1 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-isopropylaniline, 85% (CAS 81090-45-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037425-5G |
| cas | 81090-45-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 10g | 581.06 Pln | |
| Fluorochem | 25g | 1106.92 Pln |
| purity | 85% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dibromo-6-propan-2-ylaniline (CAS 81090-45-1) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,4-dibromo-6-propan-2-ylaniline. InChIKey: OKIHDLUSXGDARZ-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,4-dibromo-6-propan-2-ylaniline |
| InChIKey | OKIHDLUSXGDARZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)