2,4-Dichloro-3-(trifluoromethyl)pyridine, 95%
cas: 1186194-98-8 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-(trifluoromethyl)pyridine, 95% (CAS 1186194-98-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A464707-250mg |
| cas | 1186194-98-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 548.38 Pln | |
| Ambeed | 25g | 2133.69 Pln | |
| Ambeed | 100g | 6683.81 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 580.93 Pln | |
| BLDpharm | 25g | 2296.99 Pln | |
| BLDpharm | 100g | 7200.82 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,4-dichloro-3-(trifluoromethyl)pyridine (CAS 1186194-98-8) is a chemical compound with the molecular formula C6H2Cl2F3N and a molecular weight of 215.98 g/mol. IUPAC name: 2,4-dichloro-3-(trifluoromethyl)pyridine. InChIKey: NXLBDZNYRDNGIN-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F3N |
|---|---|
| Molecular weight | 215.98 g/mol |
| IUPAC name | 2,4-dichloro-3-(trifluoromethyl)pyridine |
| InChIKey | NXLBDZNYRDNGIN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)