CAS 1186194-98-8 appears in our catalog under these names: 2,4-Dichloro-3-(trifluoromethyl)pyridine, 98%, 2,4-Dichloro-3-(trifluoromethyl)pyridine, 95%, 95%, 2,4-Dichloro-3-(trifluoromethyl)pyridine, 95%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250mg.
2,4-dichloro-3-(trifluoromethyl)pyridine (CAS 1186194-98-8) is a chemical compound with the molecular formula C6H2Cl2F3N and a molecular weight of 215.98 g/mol. IUPAC name: 2,4-dichloro-3-(trifluoromethyl)pyridine. InChIKey: NXLBDZNYRDNGIN-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F3N |
|---|---|
| Molecular weight | 215.98 g/mol |
| IUPAC name | 2,4-dichloro-3-(trifluoromethyl)pyridine |
| InChIKey | NXLBDZNYRDNGIN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)