CAS 7655-72-3 appears in our catalog under these names: 3,5-Dichloro-2-(trifluoromethyl)pyridine, 98%, 3,5-Dichloro-2-(trifluoromethyl)pyridine, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 100mg, 1g.
3,5-dichloro-2-(trifluoromethyl)pyridine (CAS 7655-72-3) is a chemical compound with the molecular formula C6H2Cl2F3N and a molecular weight of 215.98 g/mol. IUPAC name: 3,5-dichloro-2-(trifluoromethyl)pyridine. InChIKey: WSALYASKYGIWGP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F3N |
|---|---|
| Molecular weight | 215.98 g/mol |
| IUPAC name | 3,5-dichloro-2-(trifluoromethyl)pyridine |
| InChIKey | WSALYASKYGIWGP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)