cas: 874773-65-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-fluorobenzenesulfonyl chloride (CAS 874773-65-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F067886-250MG |
| cas | 874773-65-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 633.13 Pln |
| delivery time | 2-3 weeks |
|---|
2,4-dichloro-5-fluorobenzenesulfonyl chloride (CAS 874773-65-6) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,4-dichloro-5-fluorobenzenesulfonyl chloride. InChIKey: ZCMMZABUTDMFDX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3FO2S |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2,4-dichloro-5-fluorobenzenesulfonyl chloride |
| InChIKey | ZCMMZABUTDMFDX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)Cl)F |
Computed by PubChem (NCBI)