Products 874773-65-6

CAS 874773-65-6 appears in our catalog under these names: 2,4-Dichloro-5-fluorobenzenesulfonyl chloride, 95%, 2,4-Dichloro-5-fluorobenzenesulfonyl chloride, 98+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-fluorobenzenesulfonyl chloride (CAS 874773-65-6) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,4-dichloro-5-fluorobenzenesulfonyl chloride. InChIKey: ZCMMZABUTDMFDX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl3FO2S
Molecular weight263.5 g/mol
IUPAC name2,4-dichloro-5-fluorobenzenesulfonyl chloride
InChIKeyZCMMZABUTDMFDX-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)Cl)F

Computed by PubChem (NCBI)