CAS 874773-65-6 appears in our catalog under these names: 2,4-Dichloro-5-fluorobenzenesulfonyl chloride, 95%, 2,4-Dichloro-5-fluorobenzenesulfonyl chloride, 98+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
2,4-dichloro-5-fluorobenzenesulfonyl chloride (CAS 874773-65-6) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,4-dichloro-5-fluorobenzenesulfonyl chloride. InChIKey: ZCMMZABUTDMFDX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3FO2S |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2,4-dichloro-5-fluorobenzenesulfonyl chloride |
| InChIKey | ZCMMZABUTDMFDX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)Cl)F |
Computed by PubChem (NCBI)