cas: 874773-65-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-fluorobenzenesulfonyl chloride, 98+% (CAS 874773-65-6) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A659657-25g |
| cas | 874773-65-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 12315.31 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dichloro-5-fluorobenzenesulfonyl chloride (CAS 874773-65-6) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,4-dichloro-5-fluorobenzenesulfonyl chloride. InChIKey: ZCMMZABUTDMFDX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3FO2S |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2,4-dichloro-5-fluorobenzenesulfonyl chloride |
| InChIKey | ZCMMZABUTDMFDX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)Cl)F |
Computed by PubChem (NCBI)