Products 1706436-29-4

CAS 1706436-29-4 appears in our catalog under these names: 3,6-Dichloro-2-fluorobenzenesulfonyl chloride, 95%, 3,6-Dichloro-2-fluorobenzenesulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,6-dichloro-2-fluorobenzenesulfonyl chloride (CAS 1706436-29-4) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 3,6-dichloro-2-fluorobenzenesulfonyl chloride. InChIKey: TWLCGJUQNLZYNG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl3FO2S
Molecular weight263.5 g/mol
IUPAC name3,6-dichloro-2-fluorobenzenesulfonyl chloride
InChIKeyTWLCGJUQNLZYNG-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1Cl)F)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)