Products 1012785-51-1

CAS 1012785-51-1 appears in our catalog under these names: 2,4-Dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine, 98%, 98%, 2,4-Dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine (CAS 1012785-51-1) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: RIRSSBIXHXMTLS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2IN3
Molecular weight313.91 g/mol
IUPAC name2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine
InChIKeyRIRSSBIXHXMTLS-UHFFFAOYSA-N
SMILESC1=C(C2=C(N1)N=C(N=C2Cl)Cl)I

Computed by PubChem (NCBI)