Products 2640353-16-6
CAS 2640353-16-6 is the registry number for 3,5-dichloro-6-iodo-pyrazolo[1,5-a]pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
3,5-dichloro-6-iodopyrazolo[1,5-a]pyrimidine (CAS 2640353-16-6) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 3,5-dichloro-6-iodopyrazolo[1,5-a]pyrimidine. InChIKey: HGSURTLFDXBZGO-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2IN3 |
|---|---|
| Molecular weight | 313.91 g/mol |
| IUPAC name | 3,5-dichloro-6-iodopyrazolo[1,5-a]pyrimidine |
| InChIKey | HGSURTLFDXBZGO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC2=C(C=NN21)Cl)Cl)I |
Computed by PubChem (NCBI)