Products 1313738-97-4
CAS 1313738-97-4 is the registry number for 2,4-Dichloro-6-iodopyrrolo[2,1-f][1,2,4]triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,4-dichloro-6-iodopyrrolo[2,1-f][1,2,4]triazine (CAS 1313738-97-4) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 2,4-dichloro-6-iodopyrrolo[2,1-f][1,2,4]triazine. InChIKey: COKYXHLFNIWPAL-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2IN3 |
|---|---|
| Molecular weight | 313.91 g/mol |
| IUPAC name | 2,4-dichloro-6-iodopyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | COKYXHLFNIWPAL-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C=C1I)Cl)Cl |
Computed by PubChem (NCBI)