CAS 1638760-47-0 appears in our catalog under these names: 2,4-Dichloro-6-iodo-7h-pyrrolo[2,3-d]pyrimidine, 95%, 2,4-Dichloro-6-iodo-7H-pyrrolo(2,3-d)pyrimidine, 97%, 2,4-Dichloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
2,4-dichloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine (CAS 1638760-47-0) is a chemical compound with the molecular formula C6H2Cl2IN3 and a molecular weight of 313.91 g/mol. IUPAC name: 2,4-dichloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: WLDZKOXGMANWEW-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2IN3 |
|---|---|
| Molecular weight | 313.91 g/mol |
| IUPAC name | 2,4-dichloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | WLDZKOXGMANWEW-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1C(=NC(=N2)Cl)Cl)I |
Computed by PubChem (NCBI)