cas: 56035-64-4 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-methylpyrimidine-5-carbonitrile 95% (CAS 56035-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A302198-100mg |
| cas | 56035-64-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1304.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A302198 |
2,4-dichloro-6-methylpyrimidine-5-carbonitrile (CAS 56035-64-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,4-dichloro-6-methylpyrimidine-5-carbonitrile. InChIKey: YQBPLKJZELWYDH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,4-dichloro-6-methylpyrimidine-5-carbonitrile |
| InChIKey | YQBPLKJZELWYDH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)Cl)C#N |
Computed by PubChem (NCBI)