cas: 56035-64-4 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-methylpyrimidine-5-carbonitrile, 95%, 95% (CAS 56035-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FQU-100mg |
| cas | 56035-64-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1120.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-methylpyrimidine-5-carbonitrile (CAS 56035-64-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,4-dichloro-6-methylpyrimidine-5-carbonitrile. InChIKey: YQBPLKJZELWYDH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,4-dichloro-6-methylpyrimidine-5-carbonitrile |
| InChIKey | YQBPLKJZELWYDH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)Cl)C#N |
Computed by PubChem (NCBI)