2,4-Dichloropyrrolo[2,1-f][1,2,4]triazine, 97%, 97%
cas: 918538-05-3 — see every product listed under this CAS number, including other names
2,4-Dichloropyrrolo[2,1-f][1,2,4]triazine, 97%, 97% (CAS 918538-05-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FRP-500g |
| cas | 918538-05-3 |
| size | 500g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 21835.20 Pln | |
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 10g | 976.40 Pln | |
| Chemat | 25g | 2330.00 Pln | |
| Chemat | 50g | 4542.80 Pln | |
| Chemat | 250g | 11867.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 918538-05-3) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: BSZGZNRUUJXKKQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | BSZGZNRUUJXKKQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)