Products 918538-05-3
CAS 918538-05-3 appears in our catalog under these names: 2,4-Dichloropyrrolo[2,1-f][1,2,4]triazine, 97%, 97%, 2,4-Dichloro-pyrrolo[2,1-f][1,2,4]triazine, 97%, 2,4-Dichloropyrrolo[2,1-f][1,2,4]triazine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 500g, 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g.
2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 918538-05-3) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: BSZGZNRUUJXKKQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | BSZGZNRUUJXKKQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)