CAS 64248-61-9 appears in our catalog under these names: 2,4-Difluorobenzotrifluoride, 98%, 98%, 2,4-Difluorobenzotrifluoride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 500g.
2,4-difluoro-1-(trifluoromethyl)benzene (CAS 64248-61-9) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 2,4-difluoro-1-(trifluoromethyl)benzene. InChIKey: PQJOLFTWPSZESR-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 2,4-difluoro-1-(trifluoromethyl)benzene |
| InChIKey | PQJOLFTWPSZESR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(F)(F)F |
Computed by PubChem (NCBI)