cas: 134099-30-2 — see every product listed under this CAS number, including other names
2,4-Difluoro-3-(trifluoromethyl)benzaldehyde 98% (CAS 134099-30-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A752800-100mg |
| cas | 134099-30-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 353.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A752800 |
2,4-difluoro-3-(trifluoromethyl)benzaldehyde (CAS 134099-30-2) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethyl)benzaldehyde. InChIKey: IVVUVBIECSBSQR-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethyl)benzaldehyde |
| InChIKey | IVVUVBIECSBSQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)C(F)(F)F)F |
Computed by PubChem (NCBI)