cas: 134099-30-2 — see every product listed under this CAS number, including other names
2,4-Difluoro-3-(trifluoromethyl)benzaldehyde, 98% (CAS 134099-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F611492-250MG |
| cas | 134099-30-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 3080.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,4-difluoro-3-(trifluoromethyl)benzaldehyde (CAS 134099-30-2) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethyl)benzaldehyde. InChIKey: IVVUVBIECSBSQR-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethyl)benzaldehyde |
| InChIKey | IVVUVBIECSBSQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)C(F)(F)F)F |
Computed by PubChem (NCBI)