cas: 1451391-16-4 — see every product listed under this CAS number, including other names
2,4-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 95% (CAS 1451391-16-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXDD-250mg |
| cas | 1451391-16-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 688.40 Pln | |
| Chemat | 5g | 2560.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1451391-16-4) is a chemical compound with the molecular formula C12H15BF2O3 and a molecular weight of 256.06 g/mol. IUPAC name: 2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: LXRKTJYRVGXRII-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O3 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | LXRKTJYRVGXRII-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2O)F)F |
Computed by PubChem (NCBI)