cas: 1451391-16-4 — see every product listed under this CAS number, including other names
2,4-Difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95% (CAS 1451391-16-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694149-250MG |
| cas | 1451391-16-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 1112.13 Pln | |
| Fluorochem | 5g | 4215.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1451391-16-4) is a chemical compound with the molecular formula C12H15BF2O3 and a molecular weight of 256.06 g/mol. IUPAC name: 2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: LXRKTJYRVGXRII-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O3 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | LXRKTJYRVGXRII-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2O)F)F |
Computed by PubChem (NCBI)