Products 58811-92-0

CAS 58811-92-0 is the registry number for 2,4-Xylenesulfonic Acid Hydrate. Offered by: TRC. Available pack sizes: 10g, 5g.

Structural formula: {0} (CAS {1})

2,4-dimethylbenzenesulfonic acid;hydrate (CAS 58811-92-0) is a chemical compound with the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. IUPAC name: 2,4-dimethylbenzenesulfonic acid;hydrate. InChIKey: HDUCBEFDSITHBU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O4S
Molecular weight204.25 g/mol
IUPAC name2,4-dimethylbenzenesulfonic acid;hydrate
InChIKeyHDUCBEFDSITHBU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)S(=O)(=O)O)C.O

Computed by PubChem (NCBI)