CAS 2089246-26-2 is the registry number for (1R,3R,5S)-8-thiabicyclo(3.2.1)octane-3-carboxylic acid 8,8-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R,5S)-8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octane-3-carboxylic acid (CAS 2089246-26-2) is a chemical compound with the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. IUPAC name: (1R,5S)-8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: UTQDPFJBVRHRES-DGUCWDHESA-N.
| Molecular formula | C8H12O4S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | (1R,5S)-8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | UTQDPFJBVRHRES-DGUCWDHESA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1S2(=O)=O)C(=O)O |
Computed by PubChem (NCBI)