Products 273200-04-7

CAS 273200-04-7 is the registry number for 2,5-Dimethylbenzenesulfonic acid hydrate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 100g, 500g, 5g.

Structural formula: {0} (CAS {1})

2,5-dimethylbenzenesulfonic acid;hydrate (CAS 273200-04-7) is a chemical compound with the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. IUPAC name: 2,5-dimethylbenzenesulfonic acid;hydrate. InChIKey: VXKQOMCABCHKAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O4S
Molecular weight204.25 g/mol
IUPAC name2,5-dimethylbenzenesulfonic acid;hydrate
InChIKeyVXKQOMCABCHKAQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)S(=O)(=O)O.O

Computed by PubChem (NCBI)