CAS 1250754-10-9 appears in our catalog under these names: 6-Thiaspiro(2.5)octane-1-carboxylic acid 6,6-dioxide, 98%, 6,6-Dioxo-6lambda(6)-thiaspiro(2.5)octane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
6,6-dioxo-6lambda6-thiaspiro[2.5]octane-2-carboxylic acid (CAS 1250754-10-9) is a chemical compound with the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. IUPAC name: 6,6-dioxo-6lambda6-thiaspiro[2.5]octane-2-carboxylic acid. InChIKey: LDKARROWWIBGLE-UHFFFAOYSA-N.
| Molecular formula | C8H12O4S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 6,6-dioxo-6lambda6-thiaspiro[2.5]octane-2-carboxylic acid |
| InChIKey | LDKARROWWIBGLE-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12CC2C(=O)O |
Computed by PubChem (NCBI)