cas: 528-75-6 — see every product listed under this CAS number, including other names
2,4-Dinitrobenzaldehyde 98% (CAS 528-75-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212395-5g |
| cas | 528-75-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 203.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A212395 |
2,4-dinitrobenzaldehyde (CAS 528-75-6) is a chemical compound with the molecular formula C7H4N2O5 and a molecular weight of 196.12 g/mol. IUPAC name: 2,4-dinitrobenzaldehyde. InChIKey: ZILXIZUBLXVYPI-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O5 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 2,4-dinitrobenzaldehyde |
| InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)