cas: 1821028-80-1 — see every product listed under this CAS number, including other names
2,4-Dioxo-1,2,3,4-tetrahydroquinazoline-6-carboxylic acid, 97%, 97% (CAS 1821028-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I26M-100mg |
| cas | 1821028-80-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1168.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dioxo-1H-quinazoline-6-carboxylic acid (CAS 1821028-80-1) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 2,4-dioxo-1H-quinazoline-6-carboxylic acid. InChIKey: FDJXVHKCNJIHTB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 2,4-dioxo-1H-quinazoline-6-carboxylic acid |
| InChIKey | FDJXVHKCNJIHTB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)