CAS 1256643-38-5 is the registry number for 9-Hydroxy-4-oxo-4h-pyrido[1,2-a]pyrimidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid (CAS 1256643-38-5) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid. InChIKey: LYFDMKUCZBAGTG-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid |
| InChIKey | LYFDMKUCZBAGTG-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=C(C2=O)C(=O)O)C(=C1)O |
Computed by PubChem (NCBI)