Products 864293-00-5
CAS 864293-00-5 appears in our catalog under these names: 2,4-Dihydroxyquinazoline-7-carboxylic acid, 95%, 2,4-Dihydroxyquinazoline-7-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2,4-dioxo-1H-quinazoline-7-carboxylic acid (CAS 864293-00-5) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 2,4-dioxo-1H-quinazoline-7-carboxylic acid. InChIKey: MSNNFPGHLBKVCS-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 2,4-dioxo-1H-quinazoline-7-carboxylic acid |
| InChIKey | MSNNFPGHLBKVCS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=O)NC2=O |
Computed by PubChem (NCBI)