CAS 123604-27-3 appears in our catalog under these names: 4-Nitroindole-3-carboxylic acid, 95%, 4-Nitro-1H-indole-3-carboxylic acid, 4-Nitro-1H-indole-3-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
4-nitro-1H-indole-3-carboxylic acid (CAS 123604-27-3) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 4-nitro-1H-indole-3-carboxylic acid. InChIKey: BYWPORVVGREGBC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 4-nitro-1H-indole-3-carboxylic acid |
| InChIKey | BYWPORVVGREGBC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=CN2)C(=O)O |
Computed by PubChem (NCBI)