cas: 502935-47-9 — see every product listed under this CAS number, including other names
2,4-Diphenyl-1,3-thiazole-5-carboxylic acid, 97% (CAS 502935-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC42301CB |
| cas | 502935-47-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 75.85 Pln | |
| Thermo Scientific | 1g | 235.19 Pln | |
| Thermo Scientific | 10g | 1461.06 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,4-diphenyl-1,3-thiazole-5-carboxylic acid (CAS 502935-47-9) is a chemical compound with the molecular formula C16H11NO2S and a molecular weight of 281.3 g/mol. IUPAC name: 2,4-diphenyl-1,3-thiazole-5-carboxylic acid. InChIKey: KMOCHRNIGWCEJV-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2S |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 2,4-diphenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | KMOCHRNIGWCEJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)