cas: 502935-47-9 — see every product listed under this CAS number, including other names
2,4-Diphenylthiazole-5-carboxylic acid, 99% (CAS 502935-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A284671-250mg |
| cas | 502935-47-9 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 310.87 Pln |
| purity | 99% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-diphenyl-1,3-thiazole-5-carboxylic acid (CAS 502935-47-9) is a chemical compound with the molecular formula C16H11NO2S and a molecular weight of 281.3 g/mol. IUPAC name: 2,4-diphenyl-1,3-thiazole-5-carboxylic acid. InChIKey: KMOCHRNIGWCEJV-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2S |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 2,4-diphenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | KMOCHRNIGWCEJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)