cas: 908848-70-4 — see every product listed under this CAS number, including other names
2,4-Ditrifluoromethylphenol 97% (CAS 908848-70-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A519325-100mg |
| cas | 908848-70-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 3841.38 Pln | |
| Ambeed | 10g | 6355.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A519325 |
2,4-bis(trifluoromethyl)phenol (CAS 908848-70-4) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)phenol. InChIKey: ZYIRCUJWEIIPCK-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2,4-bis(trifluoromethyl)phenol |
| InChIKey | ZYIRCUJWEIIPCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)