cas: 18593-45-8 — see every product listed under this CAS number, including other names
2,5,6-Trimethylthieno[2,3-d]pyrimidin-4(3H)-one 98% (CAS 18593-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1357884-100mg |
| cas | 18593-45-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2050.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1357884 |
2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 18593-45-8) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: ONHXPYXOJCRCBR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | ONHXPYXOJCRCBR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)C)C |
Computed by PubChem (NCBI)