2,5-Bis(allyloxy)terephthalaldehyde, 95%
cas: 2377871-78-6 — see every product listed under this CAS number, including other names
2,5-Bis(allyloxy)terephthalaldehyde, 95% (CAS 2377871-78-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1494573-250mg |
| cas | 2377871-78-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 943.31 Pln | |
| Ambeed | 1g | 2406.25 Pln | |
| Ambeed | 5g | 9426.12 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1715.60 Pln | |
| BLDpharm | 100mg | 625.36 Pln | |
| BLDpharm | 250mg | 1014.11 Pln | |
| BLDpharm | 1g | 2591.33 Pln | |
| BLDpharm | 5g | 10155.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,5-bis(prop-2-enoxy)terephthalaldehyde (CAS 2377871-78-6) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 2,5-bis(prop-2-enoxy)terephthalaldehyde. InChIKey: NRYULNKKQYDZKB-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2,5-bis(prop-2-enoxy)terephthalaldehyde |
| InChIKey | NRYULNKKQYDZKB-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC(=C(C=C1C=O)OCC=C)C=O |
Computed by PubChem (NCBI)