CAS 15795-51-4 is the registry number for 2,2-Dimethyl-5-(4-methylbenzylidene)-1,3-dioxane-4,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2-dimethyl-5-[(4-methylphenyl)methylidene]-1,3-dioxane-4,6-dione (CAS 15795-51-4) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 2,2-dimethyl-5-[(4-methylphenyl)methylidene]-1,3-dioxane-4,6-dione. InChIKey: LWXAMCVRKGTPEK-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2,2-dimethyl-5-[(4-methylphenyl)methylidene]-1,3-dioxane-4,6-dione |
| InChIKey | LWXAMCVRKGTPEK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C=C2C(=O)OC(OC2=O)(C)C |
Computed by PubChem (NCBI)