Products 1087-21-4
CAS 1087-21-4 appears in our catalog under these names: Diallyl isophthalate, 98%, Diallyl isophthalate, 97%, DiallylIsophthalate, Diallyl Isophthalate, >98.0%(GC)(T), Diallyl Isophthalate, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1kg, 100g, 500g, 25g, 5g, 10g.
Bis(prop-2-enyl) benzene-1,3-dicarboxylate (CAS 1087-21-4) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: bis(prop-2-enyl) benzene-1,3-dicarboxylate. InChIKey: OOORLLSLMPBSPT-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | bis(prop-2-enyl) benzene-1,3-dicarboxylate |
| InChIKey | OOORLLSLMPBSPT-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC(=CC=C1)C(=O)OCC=C |
Computed by PubChem (NCBI)
Synonyms:
Diallyl isophthalate, Di-2-propenyl isophthalate, Isophthalic acid, diallyl ester, 1,3-Benzenedicarboxylic acid, di-2-propenyl ester, Dappu 100, Dapon M, Isophthalic acid, di-(2-propenyl) ester, isophtalic acid, diallyl ester, Di2propenyl isophthalate, Isophthalic acid, diallyl ester (6CI,7CI,8CI)