Products 331670-05-4

CAS 331670-05-4 is the registry number for 5-Methyl-4-[(4-methylphenoxy)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methyl-4-[(4-methylphenoxy)methyl]furan-2-carboxylic acid (CAS 331670-05-4) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 5-methyl-4-[(4-methylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: AWXJBCZMGZDXCG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O4
Molecular weight246.26 g/mol
IUPAC name5-methyl-4-[(4-methylphenoxy)methyl]furan-2-carboxylic acid
InChIKeyAWXJBCZMGZDXCG-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)OCC2=C(OC(=C2)C(=O)O)C

Computed by PubChem (NCBI)