cas: 395-64-2 — see every product listed under this CAS number, including other names
2,5-Bis(trifluoromethyl)benzaldehyde, 98%, 98% (CAS 395-64-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXMG-1g |
| cas | 395-64-2 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 400.40 Pln | |
| Chemat | 100g | 1173.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-bis(trifluoromethyl)benzaldehyde (CAS 395-64-2) is a chemical compound with the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)benzaldehyde. InChIKey: PICGJIQKPLBIES-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)benzaldehyde |
| InChIKey | PICGJIQKPLBIES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)