cas: 395-64-2 — see every product listed under this CAS number, including other names
2,5-Bis(trifluoromethyl)benzaldehyde, 98% (CAS 395-64-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013757-25G |
| cas | 395-64-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 476.93 Pln | |
| Fluorochem | 100g | 1294.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,5-bis(trifluoromethyl)benzaldehyde (CAS 395-64-2) is a chemical compound with the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)benzaldehyde. InChIKey: PICGJIQKPLBIES-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)benzaldehyde |
| InChIKey | PICGJIQKPLBIES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)