cas: 302911-98-4 — see every product listed under this CAS number, including other names
2,5-Bis(trifluoromethyl)benzyl bromide (CAS 302911-98-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013764-1G |
| cas | 302911-98-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 25g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene (CAS 302911-98-4) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene. InChIKey: CHSQGVCRNVEWIA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene |
| InChIKey | CHSQGVCRNVEWIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)C(F)(F)F |
Computed by PubChem (NCBI)