cas: 302911-98-4 — see every product listed under this CAS number, including other names
2-(Bromomethyl)-1,4-bis(trifluoromethyl)benzene 98% (CAS 302911-98-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144220-5g |
| cas | 302911-98-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144220 |
2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene (CAS 302911-98-4) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene. InChIKey: CHSQGVCRNVEWIA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene |
| InChIKey | CHSQGVCRNVEWIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)C(F)(F)F |
Computed by PubChem (NCBI)